C10H19NO — CID 89087152
(E,3S,4R)-3,4-dimethyloct-6-enamide (PubChem CID 89087152) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (E,3S,4R)-3,4-dimethyloct-6-enamide.
| Compound Name | (E,3S,4R)-3,4-dimethyloct-6-enamide |
|---|---|
| PubChem CID | 89087152 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (E,3S,4R)-3,4-dimethyloct-6-enamide |
| SMILES | C/C=C/C[C@@H](C)[C@@H](C)CC(N)=O |
| InChI | InChI=1S/C10H19NO/c1-4-5-6-8(2)9(3)7-10(11)12/h4-5,8-9H,6-7H2,1-3H3,(H2,11,12)/b5-4+/t8-,9+/m1/s1 |
| InChIKey | ZXNGQFYAVFJCJD-VJIGKBMESA-N |
| XLogP | 2.10 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|