C11H21NO3 — CID 155352131
(E,3S,4R,5R)-4-hydroxy-5-methyl-3-(methylamino)non-7-enoic acid (PubChem CID 155352131) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is (E,3S,4R,5R)-4-hydroxy-5-methyl-3-(methylamino)non-7-enoic acid.
| Compound Name | (E,3S,4R,5R)-4-hydroxy-5-methyl-3-(methylamino)non-7-enoic acid |
|---|---|
| PubChem CID | 155352131 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (E,3S,4R,5R)-4-hydroxy-5-methyl-3-(methylamino)non-7-enoic acid |
| SMILES | C/C=C/C[C@@H](C)[C@@H](O)[C@H](CC(=O)O)NC |
| InChI | InChI=1S/C11H21NO3/c1-4-5-6-8(2)11(15)9(12-3)7-10(13)14/h4-5,8-9,11-12,15H,6-7H2,1-3H3,(H,13,14)/b5-4+/t8-,9+,11-/m1/s1 |
| InChIKey | QCKXFWPVKGQDHM-RIYCMKSISA-N |
| XLogP | 1.01 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|