C7H16ClNO2 — CID 87833179
(3R)-4-methyl-3-(methylamino)pentanoic acid;hydrochloride (PubChem CID 87833179) has the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. Its IUPAC name is (3R)-4-methyl-3-(methylamino)pentanoic acid;hydrochloride.
| Compound Name | (3R)-4-methyl-3-(methylamino)pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 87833179 |
| Molecular Formula | C7H16ClNO2 |
| Molecular Weight | 181.66 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (3R)-4-methyl-3-(methylamino)pentanoic acid;hydrochloride |
| SMILES | CN[C@H](CC(=O)O)C(C)C.Cl |
| InChI | InChI=1S/C7H15NO2.ClH/c1-5(2)6(8-3)4-7(9)10;/h5-6,8H,4H2,1-3H3,(H,9,10);1H/t6-;/m1./s1 |
| InChIKey | XYTNHKGNVQYDBB-FYZOBXCZSA-N |
| XLogP | 1.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.66 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |