C10H21NO3S — CID 11031847
(3S)-3-[[(R)-tert-butylsulfinyl]amino]-4-methylpentanoic acid (PubChem CID 11031847) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is (3S)-3-[[(R)-tert-butylsulfinyl]amino]-4-methylpentanoic acid.
| Compound Name | (3S)-3-[[(R)-tert-butylsulfinyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 11031847 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (3S)-3-[[(R)-tert-butylsulfinyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)[C@H](CC(=O)O)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C10H21NO3S/c1-7(2)8(6-9(12)13)11-15(14)10(3,4)5/h7-8,11H,6H2,1-5H3,(H,12,13)/t8-,15+/m0/s1 |
| InChIKey | BLLBMBDAFAZYNE-VXJOIVPMSA-N |
| XLogP | 1.54 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |