C9H19NO3S — CID 10751477
ethyl (2S)-2-[[(R)-tert-butylsulfinyl]amino]propanoate (PubChem CID 10751477) has the molecular formula C9H19NO3S and a molecular weight of 221.32 g/mol. Its IUPAC name is ethyl (2S)-2-[[(R)-tert-butylsulfinyl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[(R)-tert-butylsulfinyl]amino]propanoate |
|---|---|
| PubChem CID | 10751477 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | ethyl (2S)-2-[[(R)-tert-butylsulfinyl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C9H19NO3S/c1-6-13-8(11)7(2)10-14(12)9(3,4)5/h7,10H,6H2,1-5H3/t7-,14+/m0/s1 |
| InChIKey | JTJZESZHNOOBFQ-JKYUHCHBSA-N |
| XLogP | 0.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |