C11H21NO3S — CID 125476863
ethyl (2R)-2-[[(R)-tert-butylsulfinyl]amino]pent-4-enoate (PubChem CID 125476863) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is ethyl (2R)-2-[[(R)-tert-butylsulfinyl]amino]pent-4-enoate.
| Compound Name | ethyl (2R)-2-[[(R)-tert-butylsulfinyl]amino]pent-4-enoate |
|---|---|
| PubChem CID | 125476863 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | ethyl (2R)-2-[[(R)-tert-butylsulfinyl]amino]pent-4-enoate |
| SMILES | C=CC[C@@H](N[S@](=O)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C11H21NO3S/c1-6-8-9(10(13)15-7-2)12-16(14)11(3,4)5/h6,9,12H,1,7-8H2,2-5H3/t9-,16-/m1/s1 |
| InChIKey | FXFHPESZTIEZME-JDNHERCYSA-N |
| XLogP | 1.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|