C18H24F3NO3S — CID 11545609
ethyl (2R)-2-[[(R)-tert-butylsulfinyl]amino]-4-[4-(trifluoromethyl)phenyl]pent-4-enoate (PubChem CID 11545609) has the molecular formula C18H24F3NO3S and a molecular weight of 391.46 g/mol. Its IUPAC name is ethyl (2R)-2-[[(R)-tert-butylsulfinyl]amino]-4-[4-(trifluoromethyl)phenyl]pent-4-enoate.
| Compound Name | ethyl (2R)-2-[[(R)-tert-butylsulfinyl]amino]-4-[4-(trifluoromethyl)phenyl]pent-4-enoate |
|---|---|
| PubChem CID | 11545609 |
| Molecular Formula | C18H24F3NO3S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | ethyl (2R)-2-[[(R)-tert-butylsulfinyl]amino]-4-[4-(trifluoromethyl)phenyl]pent-4-enoate |
| SMILES | C=C(C[C@@H](N[S@](=O)C(C)(C)C)C(=O)OCC)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H24F3NO3S/c1-6-25-16(23)15(22-26(24)17(3,4)5)11-12(2)13-7-9-14(10-8-13)18(19,20)21/h7-10,15,22H,2,6,11H2,1,3-5H3/t15-,26-/m1/s1 |
| InChIKey | FWVIENWZLDDRQR-PVPMGCCUSA-N |
| XLogP | 4.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |