C17H26NO3S+ — CID 143200350
tert-butyl-[[(2R)-1-ethoxy-1-oxo-4-phenylpent-4-en-2-yl]amino]-hydroxysulfanium (PubChem CID 143200350) has the molecular formula C17H26NO3S+ and a molecular weight of 324.47 g/mol. Its IUPAC name is tert-butyl-[[(2R)-1-ethoxy-1-oxo-4-phenylpent-4-en-2-yl]amino]-hydroxysulfanium.
| Compound Name | tert-butyl-[[(2R)-1-ethoxy-1-oxo-4-phenylpent-4-en-2-yl]amino]-hydroxysulfanium |
|---|---|
| PubChem CID | 143200350 |
| Molecular Formula | C17H26NO3S+ |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | tert-butyl-[[(2R)-1-ethoxy-1-oxo-4-phenylpent-4-en-2-yl]amino]-hydroxysulfanium |
| SMILES | C=C(C[C@@H](N[S+](O)C(C)(C)C)C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C17H26NO3S/c1-6-21-16(19)15(18-22(20)17(3,4)5)12-13(2)14-10-8-7-9-11-14/h7-11,15,18,20H,2,6,12H2,1,3-5H3/q+1/t15-,22?/m1/s1 |
| InChIKey | JMCGJUZTSXJOCM-JGHKVMFLSA-N |
| XLogP | 3.42 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|