C20H27N2O3S+ — CID 148741232
tert-butyl-[[(1S)-3-ethoxy-3-oxo-1-(5-phenyl-3-pyridinyl)propyl]amino]-hydroxysulfanium (PubChem CID 148741232) has the molecular formula C20H27N2O3S+ and a molecular weight of 375.51 g/mol. Its IUPAC name is tert-butyl-[[(1S)-3-ethoxy-3-oxo-1-(5-phenyl-3-pyridinyl)propyl]amino]-hydroxysulfanium.
| Compound Name | tert-butyl-[[(1S)-3-ethoxy-3-oxo-1-(5-phenyl-3-pyridinyl)propyl]amino]-hydroxysulfanium |
|---|---|
| PubChem CID | 148741232 |
| Molecular Formula | C20H27N2O3S+ |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | tert-butyl-[[(1S)-3-ethoxy-3-oxo-1-(5-phenyl-3-pyridinyl)propyl]amino]-hydroxysulfanium |
| SMILES | CCOC(=O)C[C@H](N[S+](O)C(C)(C)C)c1cncc(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H27N2O3S/c1-5-25-19(23)12-18(22-26(24)20(2,3)4)17-11-16(13-21-14-17)15-9-7-6-8-10-15/h6-11,13-14,18,22,24H,5,12H2,1-4H3/q+1/t18-,26?/m0/s1 |
| InChIKey | OCWOGLJIMCAWGA-MDYZWHIJSA-N |
| XLogP | 4.14 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|