C25H24F3NO4S — CID 175965305
[[(1S)-3-ethoxy-3-oxo-1-[3-phenyl-4-(trifluoromethoxy)phenyl]propyl]amino]-(4-methylphenyl)-oxidosulfanium (PubChem CID 175965305) has the molecular formula C25H24F3NO4S and a molecular weight of 491.53 g/mol. Its IUPAC name is [[(1S)-3-ethoxy-3-oxo-1-[3-phenyl-4-(trifluoromethoxy)phenyl]propyl]amino]-(4-methylphenyl)-oxidosulfanium.
| Compound Name | [[(1S)-3-ethoxy-3-oxo-1-[3-phenyl-4-(trifluoromethoxy)phenyl]propyl]amino]-(4-methylphenyl)-oxidosulfanium |
|---|---|
| PubChem CID | 175965305 |
| Molecular Formula | C25H24F3NO4S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | [[(1S)-3-ethoxy-3-oxo-1-[3-phenyl-4-(trifluoromethoxy)phenyl]propyl]amino]-(4-methylphenyl)-oxidosulfanium |
| SMILES | CCOC(=O)C[C@H](N[S+]([O-])c1ccc(C)cc1)c1ccc(OC(F)(F)F)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C25H24F3NO4S/c1-3-32-24(30)16-22(29-34(31)20-12-9-17(2)10-13-20)19-11-14-23(33-25(26,27)28)21(15-19)18-7-5-4-6-8-18/h4-15,22,29H,3,16H2,1-2H3/t22-,34?/m0/s1 |
| InChIKey | MQBXIDDXZMZUQH-DAXAVGQISA-N |
| XLogP | 5.87 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|