C18H18F3NO3 — CID 175004873
ethyl 3-amino-3-[3-[2-(trifluoromethoxy)phenyl]phenyl]propanoate (PubChem CID 175004873) has the molecular formula C18H18F3NO3 and a molecular weight of 353.34 g/mol. Its IUPAC name is ethyl 3-amino-3-[3-[2-(trifluoromethoxy)phenyl]phenyl]propanoate.
| Compound Name | ethyl 3-amino-3-[3-[2-(trifluoromethoxy)phenyl]phenyl]propanoate |
|---|---|
| PubChem CID | 175004873 |
| Molecular Formula | C18H18F3NO3 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | ethyl 3-amino-3-[3-[2-(trifluoromethoxy)phenyl]phenyl]propanoate |
| SMILES | CCOC(=O)CC(N)c1cccc(-c2ccccc2OC(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F3NO3/c1-2-24-17(23)11-15(22)13-7-5-6-12(10-13)14-8-3-4-9-16(14)25-18(19,20)21/h3-10,15H,2,11,22H2,1H3 |
| InChIKey | VAIWQDLYXXWNIS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |