C12H13ClF3NO3 — CID 140815184
ethyl (3R)-3-amino-3-[2-chloro-6-(trifluoromethoxy)phenyl]propanoate (PubChem CID 140815184) has the molecular formula C12H13ClF3NO3 and a molecular weight of 311.69 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-[2-chloro-6-(trifluoromethoxy)phenyl]propanoate.
| Compound Name | ethyl (3R)-3-amino-3-[2-chloro-6-(trifluoromethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 140815184 |
| Molecular Formula | C12H13ClF3NO3 |
| Molecular Weight | 311.69 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | ethyl (3R)-3-amino-3-[2-chloro-6-(trifluoromethoxy)phenyl]propanoate |
| SMILES | CCOC(=O)C[C@@H](N)c1c(Cl)cccc1OC(F)(F)F |
| InChI | InChI=1S/C12H13ClF3NO3/c1-2-19-10(18)6-8(17)11-7(13)4-3-5-9(11)20-12(14,15)16/h3-5,8H,2,6,17H2,1H3/t8-/m1/s1 |
| InChIKey | ZHDWSYJAGOAIMA-MRVPVSSYSA-N |
| XLogP | 3.19 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.69 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |