C17H16F3NO4 — CID 135367055
(3S)-3-amino-3-[3-(3-methoxyphenyl)-4-(trifluoromethoxy)phenyl]propanoic acid (PubChem CID 135367055) has the molecular formula C17H16F3NO4 and a molecular weight of 355.31 g/mol. Its IUPAC name is (3S)-3-amino-3-[3-(3-methoxyphenyl)-4-(trifluoromethoxy)phenyl]propanoic acid.
| Compound Name | (3S)-3-amino-3-[3-(3-methoxyphenyl)-4-(trifluoromethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 135367055 |
| Molecular Formula | C17H16F3NO4 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | (3S)-3-amino-3-[3-(3-methoxyphenyl)-4-(trifluoromethoxy)phenyl]propanoic acid |
| SMILES | COc1cccc(-c2cc([C@@H](N)CC(=O)O)ccc2OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F3NO4/c1-24-12-4-2-3-10(7-12)13-8-11(14(21)9-16(22)23)5-6-15(13)25-17(18,19)20/h2-8,14H,9,21H2,1H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | GXKQNCWFXIYZAJ-AWEZNQCLSA-N |
| XLogP | 3.74 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |