C18H27NO3S — CID 71573468
ethyl (4S)-4-[[(R)-tert-butylsulfinyl]amino]-2-methylidene-5-phenylpentanoate (PubChem CID 71573468) has the molecular formula C18H27NO3S and a molecular weight of 337.49 g/mol. Its IUPAC name is ethyl (4S)-4-[[(R)-tert-butylsulfinyl]amino]-2-methylidene-5-phenylpentanoate.
| Compound Name | ethyl (4S)-4-[[(R)-tert-butylsulfinyl]amino]-2-methylidene-5-phenylpentanoate |
|---|---|
| PubChem CID | 71573468 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | ethyl (4S)-4-[[(R)-tert-butylsulfinyl]amino]-2-methylidene-5-phenylpentanoate |
| SMILES | C=C(C[C@H](Cc1ccccc1)N[S@](=O)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C18H27NO3S/c1-6-22-17(20)14(2)12-16(19-23(21)18(3,4)5)13-15-10-8-7-9-11-15/h7-11,16,19H,2,6,12-13H2,1,3-5H3/t16-,23-/m1/s1 |
| InChIKey | FOYBGLZPQWIJNX-WAIKUNEKSA-N |
| XLogP | 3.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|