C22H29NO3S — CID 102507934
ethyl (2S,3R)-2-benzyl-3-(tert-butylsulfinylamino)-3-phenylpropanoate (PubChem CID 102507934) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is ethyl (2S,3R)-2-benzyl-3-(tert-butylsulfinylamino)-3-phenylpropanoate.
| Compound Name | ethyl (2S,3R)-2-benzyl-3-(tert-butylsulfinylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 102507934 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | ethyl (2S,3R)-2-benzyl-3-(tert-butylsulfinylamino)-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@@H](Cc1ccccc1)[C@@H](NS(=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H29NO3S/c1-5-26-21(24)19(16-17-12-8-6-9-13-17)20(18-14-10-7-11-15-18)23-27(25)22(2,3)4/h6-15,19-20,23H,5,16H2,1-4H3/t19-,20-,27?/m0/s1 |
| InChIKey | FPAGNIQJLBQVEZ-BPGSNBDMSA-N |
| XLogP | 4.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |