C24H33NO4S — CID 101209671
(4-methoxyphenyl)methyl (2S,3R)-2-benzyl-3-(tert-butylsulfinylamino)pentanoate (PubChem CID 101209671) has the molecular formula C24H33NO4S and a molecular weight of 431.60 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (2S,3R)-2-benzyl-3-(tert-butylsulfinylamino)pentanoate.
| Compound Name | (4-methoxyphenyl)methyl (2S,3R)-2-benzyl-3-(tert-butylsulfinylamino)pentanoate |
|---|---|
| PubChem CID | 101209671 |
| Molecular Formula | C24H33NO4S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | (4-methoxyphenyl)methyl (2S,3R)-2-benzyl-3-(tert-butylsulfinylamino)pentanoate |
| SMILES | CC[C@@H](NS(=O)C(C)(C)C)[C@H](Cc1ccccc1)C(=O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H33NO4S/c1-6-22(25-30(27)24(2,3)4)21(16-18-10-8-7-9-11-18)23(26)29-17-19-12-14-20(28-5)15-13-19/h7-15,21-22,25H,6,16-17H2,1-5H3/t21-,22+,30?/m0/s1 |
| InChIKey | VQRGKPUFBHBGQS-FINJQHJWSA-N |
| XLogP | 4.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |