C29H39NO6S — CID 102405348
1-O-benzyl 9-O-[(4-methoxyphenyl)methyl] (Z,7R,8S)-7-(tert-butylsulfinylamino)-8-methylnon-4-enedioate (PubChem CID 102405348) has the molecular formula C29H39NO6S and a molecular weight of 529.70 g/mol. Its IUPAC name is 1-O-benzyl 9-O-[(4-methoxyphenyl)methyl] (Z,7R,8S)-7-(tert-butylsulfinylamino)-8-methylnon-4-enedioate.
| Compound Name | 1-O-benzyl 9-O-[(4-methoxyphenyl)methyl] (Z,7R,8S)-7-(tert-butylsulfinylamino)-8-methylnon-4-enedioate |
|---|---|
| PubChem CID | 102405348 |
| Molecular Formula | C29H39NO6S |
| Molecular Weight | 529.70 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 1-O-benzyl 9-O-[(4-methoxyphenyl)methyl] (Z,7R,8S)-7-(tert-butylsulfinylamino)-8-methylnon-4-enedioate |
| SMILES | COc1ccc(COC(=O)[C@@H](C)[C@@H](C/C=C\CCC(=O)OCc2ccccc2)NS(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H39NO6S/c1-22(28(32)36-21-24-16-18-25(34-5)19-17-24)26(30-37(33)29(2,3)4)14-10-7-11-15-27(31)35-20-23-12-8-6-9-13-23/h6-10,12-13,16-19,22,26,30H,11,14-15,20-21H2,1-5H3/b10-7-/t22-,26+,37?/m0/s1 |
| InChIKey | KASKGPYUNGTBQD-PDMFARMFSA-N |
| XLogP | 5.26 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.70 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|