C21H34N4O4S — CID 10993855
(4-methoxyphenyl)methyl (2S,3R)-2-(2-azidoethyl)-3-[[(R)-tert-butylsulfinyl]amino]-5-methylhexanoate (PubChem CID 10993855) has the molecular formula C21H34N4O4S and a molecular weight of 438.59 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (2S,3R)-2-(2-azidoethyl)-3-[[(R)-tert-butylsulfinyl]amino]-5-methylhexanoate.
| Compound Name | (4-methoxyphenyl)methyl (2S,3R)-2-(2-azidoethyl)-3-[[(R)-tert-butylsulfinyl]amino]-5-methylhexanoate |
|---|---|
| PubChem CID | 10993855 |
| Molecular Formula | C21H34N4O4S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (4-methoxyphenyl)methyl (2S,3R)-2-(2-azidoethyl)-3-[[(R)-tert-butylsulfinyl]amino]-5-methylhexanoate |
| SMILES | COc1ccc(COC(=O)[C@@H](CCN=[N+]=[N-])[C@@H](CC(C)C)N[S@](=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H34N4O4S/c1-15(2)13-19(24-30(27)21(3,4)5)18(11-12-23-25-22)20(26)29-14-16-7-9-17(28-6)10-8-16/h7-10,15,18-19,24H,11-14H2,1-6H3/t18-,19+,30+/m0/s1 |
| InChIKey | YTQLDJRKDFPHPX-AEGCXBDNSA-N |
| XLogP | 4.52 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|