C18H26N4O3S — CID 156873153
benzyl (3R)-3-[(1S,2R)-2-(azidomethyl)cyclopropyl]-3-[[(S)-tert-butylsulfinyl]amino]propanoate (PubChem CID 156873153) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is benzyl (3R)-3-[(1S,2R)-2-(azidomethyl)cyclopropyl]-3-[[(S)-tert-butylsulfinyl]amino]propanoate.
| Compound Name | benzyl (3R)-3-[(1S,2R)-2-(azidomethyl)cyclopropyl]-3-[[(S)-tert-butylsulfinyl]amino]propanoate |
|---|---|
| PubChem CID | 156873153 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | benzyl (3R)-3-[(1S,2R)-2-(azidomethyl)cyclopropyl]-3-[[(S)-tert-butylsulfinyl]amino]propanoate |
| SMILES | CC(C)(C)[S@](=O)N[C@H](CC(=O)OCc1ccccc1)[C@H]1C[C@H]1CN=[N+]=[N-] |
| InChI | InChI=1S/C18H26N4O3S/c1-18(2,3)26(24)21-16(15-9-14(15)11-20-22-19)10-17(23)25-12-13-7-5-4-6-8-13/h4-8,14-16,21H,9-12H2,1-3H3/t14-,15-,16+,26-/m0/s1 |
| InChIKey | CSLNMMSZKSOJEU-KNTYWXHESA-N |
| XLogP | 3.49 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|