C27H33F3N2O4S — CID 66940158
benzyl 3-[4-[(1R)-1-(tert-butylsulfinylamino)-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-3-oxopropanoate (PubChem CID 66940158) has the molecular formula C27H33F3N2O4S and a molecular weight of 538.63 g/mol. Its IUPAC name is benzyl 3-[4-[(1R)-1-(tert-butylsulfinylamino)-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-3-oxopropanoate.
| Compound Name | benzyl 3-[4-[(1R)-1-(tert-butylsulfinylamino)-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 66940158 |
| Molecular Formula | C27H33F3N2O4S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | benzyl 3-[4-[(1R)-1-(tert-butylsulfinylamino)-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-3-oxopropanoate |
| SMILES | CC(C)(C)S(=O)N[C@H](Cc1cc(F)c(F)cc1F)C1CCN(C(=O)CC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C27H33F3N2O4S/c1-27(2,3)37(35)31-24(14-20-13-22(29)23(30)15-21(20)28)19-9-11-32(12-10-19)25(33)16-26(34)36-17-18-7-5-4-6-8-18/h4-8,13,15,19,24,31H,9-12,14,16-17H2,1-3H3/t24-,37?/m1/s1 |
| InChIKey | VEWUFPKKUMONRX-ABSAFCAXSA-N |
| XLogP | 4.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|