C23H27F3N2O — CID 70311550
1-[4-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-4-phenylbutan-1-one (PubChem CID 70311550) has the molecular formula C23H27F3N2O and a molecular weight of 404.48 g/mol. Its IUPAC name is 1-[4-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-4-phenylbutan-1-one.
| Compound Name | 1-[4-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 70311550 |
| Molecular Formula | C23H27F3N2O |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 1-[4-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-4-phenylbutan-1-one |
| SMILES | N[C@H](Cc1cc(F)c(F)cc1F)C1CCN(C(=O)CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H27F3N2O/c24-19-15-21(26)20(25)13-18(19)14-22(27)17-9-11-28(12-10-17)23(29)8-4-7-16-5-2-1-3-6-16/h1-3,5-6,13,15,17,22H,4,7-12,14,27H2/t22-/m1/s1 |
| InChIKey | QCVAZBKEJUAJHY-JOCHJYFZSA-N |
| XLogP | 4.24 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|