C17H21F3N2O3 — CID 77201729
4-[4-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-4-oxobutanoic acid (PubChem CID 77201729) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is 4-[4-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-4-oxobutanoic acid.
| Compound Name | 4-[4-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 77201729 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-[4-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-4-oxobutanoic acid |
| SMILES | NC(Cc1cc(F)c(F)cc1F)C1CCN(C(=O)CCC(=O)O)CC1 |
| InChI | InChI=1S/C17H21F3N2O3/c18-12-9-14(20)13(19)7-11(12)8-15(21)10-3-5-22(6-4-10)16(23)1-2-17(24)25/h7,9-10,15H,1-6,8,21H2,(H,24,25) |
| InChIKey | VNDQSASHBFUHSO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|