C18H24F3N3O2 — CID 70311276
3-[4-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-N-ethyl-3-oxopropanamide (PubChem CID 70311276) has the molecular formula C18H24F3N3O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is 3-[4-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-N-ethyl-3-oxopropanamide.
| Compound Name | 3-[4-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-N-ethyl-3-oxopropanamide |
|---|---|
| PubChem CID | 70311276 |
| Molecular Formula | C18H24F3N3O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 3-[4-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-N-ethyl-3-oxopropanamide |
| SMILES | CCNC(=O)CC(=O)N1CCC([C@H](N)Cc2cc(F)c(F)cc2F)CC1 |
| InChI | InChI=1S/C18H24F3N3O2/c1-2-23-17(25)10-18(26)24-5-3-11(4-6-24)16(22)8-12-7-14(20)15(21)9-13(12)19/h7,9,11,16H,2-6,8,10,22H2,1H3,(H,23,25)/t16-/m1/s1 |
| InChIKey | WYMYXWWXGSTMID-MRXNPFEDSA-N |
| XLogP | 1.74 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|