C17H22F3N3O2 — CID 24754171
N-[1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperidin-4-yl]acetamide (PubChem CID 24754171) has the molecular formula C17H22F3N3O2 and a molecular weight of 357.38 g/mol. Its IUPAC name is N-[1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperidin-4-yl]acetamide.
| Compound Name | N-[1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 24754171 |
| Molecular Formula | C17H22F3N3O2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperidin-4-yl]acetamide |
| SMILES | CC(=O)NC1CCN(C(=O)C[C@H](N)Cc2cc(F)c(F)cc2F)CC1 |
| InChI | InChI=1S/C17H22F3N3O2/c1-10(24)22-13-2-4-23(5-3-13)17(25)8-12(21)6-11-7-15(19)16(20)9-14(11)18/h7,9,12-13H,2-6,8,21H2,1H3,(H,22,24)/t12-/m1/s1 |
| InChIKey | JCJIQFYGCBRBLK-GFCCVEGCSA-N |
| XLogP | 1.49 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|