C18H26F3N3O3S — CID 91289973
N-[1-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperidin-4-yl]propane-2-sulfonamide (PubChem CID 91289973) has the molecular formula C18H26F3N3O3S and a molecular weight of 421.49 g/mol. Its IUPAC name is N-[1-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperidin-4-yl]propane-2-sulfonamide.
| Compound Name | N-[1-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperidin-4-yl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 91289973 |
| Molecular Formula | C18H26F3N3O3S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-[1-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperidin-4-yl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NC1CCN(C(=O)CC(N)Cc2cc(F)c(F)cc2F)CC1 |
| InChI | InChI=1S/C18H26F3N3O3S/c1-11(2)28(26,27)23-14-3-5-24(6-4-14)18(25)9-13(22)7-12-8-16(20)17(21)10-15(12)19/h8,10-11,13-14,23H,3-7,9,22H2,1-2H3 |
| InChIKey | HPXGKADZDGRNFN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|