C22H22F3N3O4 — CID 11854299
3-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazine-1-carbonyl]benzoic acid (PubChem CID 11854299) has the molecular formula C22H22F3N3O4 and a molecular weight of 449.43 g/mol. Its IUPAC name is 3-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazine-1-carbonyl]benzoic acid.
| Compound Name | 3-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 11854299 |
| Molecular Formula | C22H22F3N3O4 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 3-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazine-1-carbonyl]benzoic acid |
| SMILES | N[C@@H](CC(=O)N1CCN(C(=O)c2cccc(C(=O)O)c2)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C22H22F3N3O4/c23-17-12-19(25)18(24)10-15(17)9-16(26)11-20(29)27-4-6-28(7-5-27)21(30)13-2-1-3-14(8-13)22(31)32/h1-3,8,10,12,16H,4-7,9,11,26H2,(H,31,32)/t16-/m1/s1 |
| InChIKey | LJDGJZNBWICGDO-MRXNPFEDSA-N |
| XLogP | 2.05 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|