C23H25ClF3N3O4 — CID 44571689
(3R)-3-amino-1-[4-(1,3-benzodioxole-5-carbonyl)-1,4-diazepan-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride (PubChem CID 44571689) has the molecular formula C23H25ClF3N3O4 and a molecular weight of 499.92 g/mol. Its IUPAC name is (3R)-3-amino-1-[4-(1,3-benzodioxole-5-carbonyl)-1,4-diazepan-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride.
| Compound Name | (3R)-3-amino-1-[4-(1,3-benzodioxole-5-carbonyl)-1,4-diazepan-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 44571689 |
| Molecular Formula | C23H25ClF3N3O4 |
| Molecular Weight | 499.92 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | (3R)-3-amino-1-[4-(1,3-benzodioxole-5-carbonyl)-1,4-diazepan-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride |
| SMILES | Cl.N[C@@H](CC(=O)N1CCCN(C(=O)c2ccc3c(c2)OCO3)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C23H24F3N3O4.ClH/c24-17-12-19(26)18(25)9-15(17)8-16(27)11-22(30)28-4-1-5-29(7-6-28)23(31)14-2-3-20-21(10-14)33-13-32-20;/h2-3,9-10,12,16H,1,4-8,11,13,27H2;1H/t16-;/m1./s1 |
| InChIKey | QQCXUNPCOVMAPG-PKLMIRHRSA-N |
| XLogP | 2.89 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.92 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|