C21H24ClF3N4O2 — CID 44571734
(3R)-3-amino-1-[4-(pyridine-3-carbonyl)-1,4-diazepan-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride (PubChem CID 44571734) has the molecular formula C21H24ClF3N4O2 and a molecular weight of 456.90 g/mol. Its IUPAC name is (3R)-3-amino-1-[4-(pyridine-3-carbonyl)-1,4-diazepan-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride.
| Compound Name | (3R)-3-amino-1-[4-(pyridine-3-carbonyl)-1,4-diazepan-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 44571734 |
| Molecular Formula | C21H24ClF3N4O2 |
| Molecular Weight | 456.90 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | (3R)-3-amino-1-[4-(pyridine-3-carbonyl)-1,4-diazepan-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride |
| SMILES | Cl.N[C@@H](CC(=O)N1CCCN(C(=O)c2cccnc2)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H23F3N4O2.ClH/c22-17-12-19(24)18(23)10-15(17)9-16(25)11-20(29)27-5-2-6-28(8-7-27)21(30)14-3-1-4-26-13-14;/h1,3-4,10,12-13,16H,2,5-9,11,25H2;1H/t16-;/m1./s1 |
| InChIKey | NZWCOMSBSKSHHN-PKLMIRHRSA-N |
| XLogP | 2.56 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.90 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|