C22H25ClF3N3O5S — CID 44571897
4-[[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,4-diazepan-1-yl]sulfonyl]benzoic acid;hydrochloride (PubChem CID 44571897) has the molecular formula C22H25ClF3N3O5S and a molecular weight of 535.97 g/mol. Its IUPAC name is 4-[[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,4-diazepan-1-yl]sulfonyl]benzoic acid;hydrochloride.
| Compound Name | 4-[[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,4-diazepan-1-yl]sulfonyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 44571897 |
| Molecular Formula | C22H25ClF3N3O5S |
| Molecular Weight | 535.97 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | 4-[[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,4-diazepan-1-yl]sulfonyl]benzoic acid;hydrochloride |
| SMILES | Cl.N[C@@H](CC(=O)N1CCCN(S(=O)(=O)c2ccc(C(=O)O)cc2)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C22H24F3N3O5S.ClH/c23-18-13-20(25)19(24)11-15(18)10-16(26)12-21(29)27-6-1-7-28(9-8-27)34(32,33)17-4-2-14(3-5-17)22(30)31;/h2-5,11,13,16H,1,6-10,12,26H2,(H,30,31);1H/t16-;/m1./s1 |
| InChIKey | SBRYJQYSKPUYGS-PKLMIRHRSA-N |
| XLogP | 2.41 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.97 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|