C21H24F3N3O3S — CID 24859725
(3R)-3-amino-1-[(3S)-4-(benzenesulfonyl)-3-methylpiperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 24859725) has the molecular formula C21H24F3N3O3S and a molecular weight of 455.50 g/mol. Its IUPAC name is (3R)-3-amino-1-[(3S)-4-(benzenesulfonyl)-3-methylpiperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[(3S)-4-(benzenesulfonyl)-3-methylpiperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 24859725 |
| Molecular Formula | C21H24F3N3O3S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | (3R)-3-amino-1-[(3S)-4-(benzenesulfonyl)-3-methylpiperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | C[C@H]1CN(C(=O)C[C@H](N)Cc2cc(F)c(F)cc2F)CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24F3N3O3S/c1-14-13-26(7-8-27(14)31(29,30)17-5-3-2-4-6-17)21(28)11-16(25)9-15-10-19(23)20(24)12-18(15)22/h2-6,10,12,14,16H,7-9,11,13,25H2,1H3/t14-,16+/m0/s1 |
| InChIKey | GQQAGYRMCPPACV-GOEBONIOSA-N |
| XLogP | 2.29 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|