C17H24F3N3O3S — CID 91544696
N-[1-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperidin-3-yl]ethanesulfonamide (PubChem CID 91544696) has the molecular formula C17H24F3N3O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is N-[1-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperidin-3-yl]ethanesulfonamide.
| Compound Name | N-[1-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperidin-3-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 91544696 |
| Molecular Formula | C17H24F3N3O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-[1-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperidin-3-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC1CCCN(C(=O)CC(N)Cc2cc(F)c(F)cc2F)C1 |
| InChI | InChI=1S/C17H24F3N3O3S/c1-2-27(25,26)22-13-4-3-5-23(10-13)17(24)8-12(21)6-11-7-15(19)16(20)9-14(11)18/h7,9,12-13,22H,2-6,8,10,21H2,1H3 |
| InChIKey | VZMVTAFJLBCIMK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|