C18H22F3N5O — CID 155955430
(3R)-3-amino-1-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 155955430) has the molecular formula C18H22F3N5O and a molecular weight of 381.40 g/mol. Its IUPAC name is (3R)-3-amino-1-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 155955430 |
| Molecular Formula | C18H22F3N5O |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (3R)-3-amino-1-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | Cc1nc(C2CCCN(C(=O)C[C@H](N)Cc3cc(F)c(F)cc3F)C2)n[nH]1 |
| InChI | InChI=1S/C18H22F3N5O/c1-10-23-18(25-24-10)11-3-2-4-26(9-11)17(27)7-13(22)5-12-6-15(20)16(21)8-14(12)19/h6,8,11,13H,2-5,7,9,22H2,1H3,(H,23,24,25)/t11?,13-/m1/s1 |
| InChIKey | DSFGESBLDKYXTC-GLGOKHISSA-N |
| XLogP | 2.20 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|