C25H32F3N3O6 — CID 89482692
1-[(3aS,6aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-3-methylbutan-1-one;(E)-but-2-enedioic acid (PubChem CID 89482692) has the molecular formula C25H32F3N3O6 and a molecular weight of 527.54 g/mol. Its IUPAC name is 1-[(3aS,6aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-3-methylbutan-1-one;(E)-but-2-enedioic acid.
| Compound Name | 1-[(3aS,6aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-3-methylbutan-1-one;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 89482692 |
| Molecular Formula | C25H32F3N3O6 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 1-[(3aS,6aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-3-methylbutan-1-one;(E)-but-2-enedioic acid |
| SMILES | CC(C)CC(=O)N1C[C@@H]2CCN(C(=O)C[C@H](N)Cc3cc(F)c(F)cc3F)[C@@H]2C1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H28F3N3O2.C4H4O4/c1-12(2)5-20(28)26-10-13-3-4-27(19(13)11-26)21(29)8-15(25)6-14-7-17(23)18(24)9-16(14)22;5-3(6)1-2-4(7)8/h7,9,12-13,15,19H,3-6,8,10-11,25H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t13-,15+,19+;/m0./s1 |
| InChIKey | LSIMFUMNIIWYNJ-NQJNKTFMSA-N |
| XLogP | 2.18 |
| TPSA | 141.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|