C25H34F3N3O6 — CID 162009136
(3R)-1-[(3aS,6aS)-5-(2-methylpropanoyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one;(E)-3-formyloxyprop-2-enoic acid;methane (PubChem CID 162009136) has the molecular formula C25H34F3N3O6 and a molecular weight of 529.56 g/mol. Its IUPAC name is (3R)-1-[(3aS,6aS)-5-(2-methylpropanoyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one;(E)-3-formyloxyprop-2-enoic acid;methane.
| Compound Name | (3R)-1-[(3aS,6aS)-5-(2-methylpropanoyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one;(E)-3-formyloxyprop-2-enoic acid;methane |
|---|---|
| PubChem CID | 162009136 |
| Molecular Formula | C25H34F3N3O6 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | (3R)-1-[(3aS,6aS)-5-(2-methylpropanoyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one;(E)-3-formyloxyprop-2-enoic acid;methane |
| SMILES | C.CC(C)C(=O)N1C[C@@H]2CCN(C(=O)C[C@H](N)Cc3cc(F)c(F)cc3F)[C@@H]2C1.O=CO/C=C/C(=O)O |
| InChI | InChI=1S/C20H26F3N3O2.C4H4O4.CH4/c1-11(2)20(28)25-9-12-3-4-26(18(12)10-25)19(27)7-14(24)5-13-6-16(22)17(23)8-15(13)21;5-3-8-2-1-4(6)7;/h6,8,11-12,14,18H,3-5,7,9-10,24H2,1-2H3;1-3H,(H,6,7);1H4/b;2-1+;/t12-,14+,18+;;/m0../s1 |
| InChIKey | DQWIJJCDFGZJCK-OTEMBQEGSA-N |
| XLogP | 2.47 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|