C44H52F6N6O8 — CID 54674532
bis((3R)-1-[(3aS,6aS)-5-(cyclopropanecarbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one);(E)-but-2-enedioic acid (PubChem CID 54674532) has the molecular formula C44H52F6N6O8 and a molecular weight of 906.92 g/mol. Its IUPAC name is bis((3R)-1-[(3aS,6aS)-5-(cyclopropanecarbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one);(E)-but-2-enedioic acid.
| Compound Name | bis((3R)-1-[(3aS,6aS)-5-(cyclopropanecarbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one);(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 54674532 |
| Molecular Formula | C44H52F6N6O8 |
| Molecular Weight | 906.92 g/mol |
| Exact Mass | 906.38 |
| IUPAC Name | bis((3R)-1-[(3aS,6aS)-5-(cyclopropanecarbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one);(E)-but-2-enedioic acid |
| SMILES | N[C@@H](CC(=O)N1CC[C@H]2CN(C(=O)C3CC3)C[C@H]21)Cc1cc(F)c(F)cc1F.N[C@@H](CC(=O)N1CC[C@H]2CN(C(=O)C3CC3)C[C@H]21)Cc1cc(F)c(F)cc1F.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/2C20H24F3N3O2.C4H4O4/c2*21-15-8-17(23)16(22)6-13(15)5-14(24)7-19(27)26-4-3-12-9-25(10-18(12)26)20(28)11-1-2-11;5-3(6)1-2-4(7)8/h2*6,8,11-12,14,18H,1-5,7,9-10,24H2;1-2H,(H,5,6)(H,7,8)/b;;2-1+/t2*12-,14+,18+;/m00./s1 |
| InChIKey | IHNWYLZCPRDKBD-PZVCQHHFSA-N |
| XLogP | 3.38 |
| TPSA | 207.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.92 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|