C22H29F3N4O6 — CID 157349678
(3aS,6aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide;(E)-3-formyloxyprop-2-enoic acid;methane (PubChem CID 157349678) has the molecular formula C22H29F3N4O6 and a molecular weight of 502.49 g/mol. Its IUPAC name is (3aS,6aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide;(E)-3-formyloxyprop-2-enoic acid;methane.
| Compound Name | (3aS,6aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide;(E)-3-formyloxyprop-2-enoic acid;methane |
|---|---|
| PubChem CID | 157349678 |
| Molecular Formula | C22H29F3N4O6 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | (3aS,6aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide;(E)-3-formyloxyprop-2-enoic acid;methane |
| SMILES | C.NC(=O)N1C[C@@H]2CCN(C(=O)C[C@H](N)Cc3cc(F)c(F)cc3F)[C@@H]2C1.O=CO/C=C/C(=O)O |
| InChI | InChI=1S/C17H21F3N4O2.C4H4O4.CH4/c18-12-6-14(20)13(19)4-10(12)3-11(21)5-16(25)24-2-1-9-7-23(17(22)26)8-15(9)24;5-3-8-2-1-4(6)7;/h4,6,9,11,15H,1-3,5,7-8,21H2,(H2,22,26);1-3H,(H,6,7);1H4/b;2-1+;/t9-,11+,15+;;/m0../s1 |
| InChIKey | GACZLZGBUSFIHL-IHTQYMPLSA-N |
| XLogP | 1.37 |
| TPSA | 156.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|