C20H23F4N3O2 — CID 89482545
1-[(3aS,6aS)-5-(1-fluorocyclopropanecarbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 89482545) has the molecular formula C20H23F4N3O2 and a molecular weight of 413.42 g/mol. Its IUPAC name is 1-[(3aS,6aS)-5-(1-fluorocyclopropanecarbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | 1-[(3aS,6aS)-5-(1-fluorocyclopropanecarbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 89482545 |
| Molecular Formula | C20H23F4N3O2 |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 1-[(3aS,6aS)-5-(1-fluorocyclopropanecarbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | NC(CC(=O)N1CC[C@H]2CN(C(=O)C3(F)CC3)C[C@H]21)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C20H23F4N3O2/c21-14-8-16(23)15(22)6-12(14)5-13(25)7-18(28)27-4-1-11-9-26(10-17(11)27)19(29)20(24)2-3-20/h6,8,11,13,17H,1-5,7,9-10,25H2/t11-,13?,17+/m0/s1 |
| InChIKey | SQLNCUURBKVFAJ-PGECJRHESA-N |
| XLogP | 1.93 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|