C21H24F3N4O3 — CID 140611534
CID 140611534 (PubChem CID 140611534) has the molecular formula C21H24F3N4O3 and a molecular weight of 437.44 g/mol.
| Compound Name | CID 140611534 |
|---|---|
| PubChem CID | 140611534 |
| Molecular Formula | C21H24F3N4O3 |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | — |
| SMILES | [NH][C@@H](CC(=O)N1CC[C@H]2CN(C(=O)C3(C(N)=O)CC3)C[C@H]21)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H24F3N4O3/c22-14-8-16(24)15(23)6-12(14)5-13(25)7-18(29)28-4-1-11-9-27(10-17(11)28)20(31)21(2-3-21)19(26)30/h6,8,11,13,17,25H,1-5,7,9-10H2,(H2,26,30)/t11-,13+,17+/m0/s1 |
| InChIKey | QUSMXAWOCAGSGF-XTQGRXLLSA-N |
| XLogP | 1.01 |
| TPSA | 107.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|