C26H30F3N3O11 — CID 54675007
(3R)-1-[(3aS,6aS)-5-(2-hydroxyacetyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one;bis((E)-but-2-enedioic acid) (PubChem CID 54675007) has the molecular formula C26H30F3N3O11 and a molecular weight of 617.53 g/mol. Its IUPAC name is (3R)-1-[(3aS,6aS)-5-(2-hydroxyacetyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one;bis((E)-but-2-enedioic acid).
| Compound Name | (3R)-1-[(3aS,6aS)-5-(2-hydroxyacetyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one;bis((E)-but-2-enedioic acid) |
|---|---|
| PubChem CID | 54675007 |
| Molecular Formula | C26H30F3N3O11 |
| Molecular Weight | 617.53 g/mol |
| Exact Mass | 617.18 |
| IUPAC Name | (3R)-1-[(3aS,6aS)-5-(2-hydroxyacetyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one;bis((E)-but-2-enedioic acid) |
| SMILES | N[C@@H](CC(=O)N1CC[C@H]2CN(C(=O)CO)C[C@H]21)Cc1cc(F)c(F)cc1F.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H22F3N3O3.2C4H4O4/c19-13-6-15(21)14(20)4-11(13)3-12(22)5-17(26)24-2-1-10-7-23(8-16(10)24)18(27)9-25;2*5-3(6)1-2-4(7)8/h4,6,10,12,16,25H,1-3,5,7-9,22H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+/t10-,12+,16+;;/m0../s1 |
| InChIKey | YPJYEJSFRNZHMD-XVPUIPFGSA-N |
| XLogP | -0.16 |
| TPSA | 236.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.53 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|