C22H24F3N3O3S — CID 89482670
1-[(3aS,6aS)-5-(benzenesulfonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 89482670) has the molecular formula C22H24F3N3O3S and a molecular weight of 467.51 g/mol. Its IUPAC name is 1-[(3aS,6aS)-5-(benzenesulfonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | 1-[(3aS,6aS)-5-(benzenesulfonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 89482670 |
| Molecular Formula | C22H24F3N3O3S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 1-[(3aS,6aS)-5-(benzenesulfonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | NC(CC(=O)N1CC[C@H]2CN(S(=O)(=O)c3ccccc3)C[C@H]21)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C22H24F3N3O3S/c23-18-11-20(25)19(24)9-15(18)8-16(26)10-22(29)28-7-6-14-12-27(13-21(14)28)32(30,31)17-4-2-1-3-5-17/h1-5,9,11,14,16,21H,6-8,10,12-13,26H2/t14-,16?,21+/m0/s1 |
| InChIKey | IWPWAAZEWNQOLG-YYCTWMQJSA-N |
| XLogP | 2.29 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|