C21H25ClF3N3O — CID 25154806
(3R)-3-amino-1-(4-benzylpiperazin-1-yl)-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride (PubChem CID 25154806) has the molecular formula C21H25ClF3N3O and a molecular weight of 427.90 g/mol. Its IUPAC name is (3R)-3-amino-1-(4-benzylpiperazin-1-yl)-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride.
| Compound Name | (3R)-3-amino-1-(4-benzylpiperazin-1-yl)-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 25154806 |
| Molecular Formula | C21H25ClF3N3O |
| Molecular Weight | 427.90 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | (3R)-3-amino-1-(4-benzylpiperazin-1-yl)-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride |
| SMILES | Cl.N[C@@H](CC(=O)N1CCN(Cc2ccccc2)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H24F3N3O.ClH/c22-18-13-20(24)19(23)11-16(18)10-17(25)12-21(28)27-8-6-26(7-9-27)14-15-4-2-1-3-5-15;/h1-5,11,13,17H,6-10,12,14,25H2;1H/t17-;/m1./s1 |
| InChIKey | JBALYWDPJARSKE-UNTBIKODSA-N |
| XLogP | 3.13 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.90 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|