C21H22ClF3N4O4S — CID 141256212
4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-(2-chlorophenyl)sulfonylpiperazine-1-carboxamide (PubChem CID 141256212) has the molecular formula C21H22ClF3N4O4S and a molecular weight of 518.95 g/mol. Its IUPAC name is 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-(2-chlorophenyl)sulfonylpiperazine-1-carboxamide.
| Compound Name | 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-(2-chlorophenyl)sulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 141256212 |
| Molecular Formula | C21H22ClF3N4O4S |
| Molecular Weight | 518.95 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-(2-chlorophenyl)sulfonylpiperazine-1-carboxamide |
| SMILES | N[C@@H](CC(=O)N1CCN(C(=O)NS(=O)(=O)c2ccccc2Cl)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H22ClF3N4O4S/c22-15-3-1-2-4-19(15)34(32,33)27-21(31)29-7-5-28(6-8-29)20(30)11-14(26)9-13-10-17(24)18(25)12-16(13)23/h1-4,10,12,14H,5-9,11,26H2,(H,27,31)/t14-/m1/s1 |
| InChIKey | ZJBAIPFXKKEFCN-CQSZACIVSA-N |
| XLogP | 2.26 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.95 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|