C22H26F3N5O5 — CID 69255911
(3R)-1-[(2S)-2-[3-(1-acetylazetidin-3-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one;formic acid (PubChem CID 69255911) has the molecular formula C22H26F3N5O5 and a molecular weight of 497.47 g/mol. Its IUPAC name is (3R)-1-[(2S)-2-[3-(1-acetylazetidin-3-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one;formic acid.
| Compound Name | (3R)-1-[(2S)-2-[3-(1-acetylazetidin-3-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one;formic acid |
|---|---|
| PubChem CID | 69255911 |
| Molecular Formula | C22H26F3N5O5 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | (3R)-1-[(2S)-2-[3-(1-acetylazetidin-3-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one;formic acid |
| SMILES | CC(=O)N1CC(c2noc([C@@H]3CCCN3C(=O)C[C@H](N)Cc3cc(F)c(F)cc3F)n2)C1.O=CO |
| InChI | InChI=1S/C21H24F3N5O3.CH2O2/c1-11(30)28-9-13(10-28)20-26-21(32-27-20)18-3-2-4-29(18)19(31)7-14(25)5-12-6-16(23)17(24)8-15(12)22;2-1-3/h6,8,13-14,18H,2-5,7,9-10,25H2,1H3;1H,(H,2,3)/t14-,18+;/m1./s1 |
| InChIKey | XBXIPTVHWVPMEM-CQZNTPMBSA-N |
| XLogP | 1.76 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|