C21H25F3N4O4 — CID 69256400
3-amino-1-[2-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;formic acid (PubChem CID 69256400) has the molecular formula C21H25F3N4O4 and a molecular weight of 454.45 g/mol. Its IUPAC name is 3-amino-1-[2-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;formic acid.
| Compound Name | 3-amino-1-[2-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;formic acid |
|---|---|
| PubChem CID | 69256400 |
| Molecular Formula | C21H25F3N4O4 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 3-amino-1-[2-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;formic acid |
| SMILES | NC(CC(=O)N1CCCC1c1nc(C2CCC2)no1)Cc1cc(F)c(F)cc1F.O=CO |
| InChI | InChI=1S/C20H23F3N4O2.CH2O2/c21-14-10-16(23)15(22)8-12(14)7-13(24)9-18(28)27-6-2-5-17(27)20-25-19(26-29-20)11-3-1-4-11;2-1-3/h8,10-11,13,17H,1-7,9,24H2;1H,(H,2,3) |
| InChIKey | JJUVHMQCNLVWOI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|