C19H27F3N2O3S — CID 70312100
1-[4-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-3-propan-2-ylsulfonylpropan-1-one (PubChem CID 70312100) has the molecular formula C19H27F3N2O3S and a molecular weight of 420.50 g/mol. Its IUPAC name is 1-[4-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-3-propan-2-ylsulfonylpropan-1-one.
| Compound Name | 1-[4-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-3-propan-2-ylsulfonylpropan-1-one |
|---|---|
| PubChem CID | 70312100 |
| Molecular Formula | C19H27F3N2O3S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 1-[4-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-3-propan-2-ylsulfonylpropan-1-one |
| SMILES | CC(C)S(=O)(=O)CCC(=O)N1CCC(C(N)Cc2cc(F)c(F)cc2F)CC1 |
| InChI | InChI=1S/C19H27F3N2O3S/c1-12(2)28(26,27)8-5-19(25)24-6-3-13(4-7-24)18(23)10-14-9-16(21)17(22)11-15(14)20/h9,11-13,18H,3-8,10,23H2,1-2H3 |
| InChIKey | LOKLNDANIHNZOU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|