C25H31F3N2OS — CID 143553556
1-[4-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-3-[benzyl(dimethylidene)-λ6-sulfanyl]propan-1-one (PubChem CID 143553556) has the molecular formula C25H31F3N2OS and a molecular weight of 464.60 g/mol. Its IUPAC name is 1-[4-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-3-[benzyl(dimethylidene)-λ6-sulfanyl]propan-1-one.
| Compound Name | 1-[4-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-3-[benzyl(dimethylidene)-λ6-sulfanyl]propan-1-one |
|---|---|
| PubChem CID | 143553556 |
| Molecular Formula | C25H31F3N2OS |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 1-[4-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]piperidin-1-yl]-3-[benzyl(dimethylidene)-λ6-sulfanyl]propan-1-one |
| SMILES | C=S(=C)(CCC(=O)N1CCC(C(N)Cc2cc(F)c(F)cc2F)CC1)Cc1ccccc1 |
| InChI | InChI=1S/C25H31F3N2OS/c1-32(2,17-18-6-4-3-5-7-18)13-10-25(31)30-11-8-19(9-12-30)24(29)15-20-14-22(27)23(28)16-21(20)26/h3-7,14,16,19,24H,1-2,8-13,15,17,29H2 |
| InChIKey | YSMFZQCAZUSSNL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|