C30H34F3N3O6 — CID 66940090
N-[2-[(1R,5S)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]-3-phenylpropanamide;but-2-enedioic acid (PubChem CID 66940090) has the molecular formula C30H34F3N3O6 and a molecular weight of 589.61 g/mol. Its IUPAC name is N-[2-[(1R,5S)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]-3-phenylpropanamide;but-2-enedioic acid.
| Compound Name | N-[2-[(1R,5S)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]-3-phenylpropanamide;but-2-enedioic acid |
|---|---|
| PubChem CID | 66940090 |
| Molecular Formula | C30H34F3N3O6 |
| Molecular Weight | 589.61 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | N-[2-[(1R,5S)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]-3-phenylpropanamide;but-2-enedioic acid |
| SMILES | N[C@H](Cc1cc(F)c(F)cc1F)C1C[C@H]2CC[C@@H](C1)N2C(=O)CNC(=O)CCc1ccccc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C26H30F3N3O2.C4H4O4/c27-21-14-23(29)22(28)12-17(21)13-24(30)18-10-19-7-8-20(11-18)32(19)26(34)15-31-25(33)9-6-16-4-2-1-3-5-16;5-3(6)1-2-4(7)8/h1-5,12,14,18-20,24H,6-11,13,15,30H2,(H,31,33);1-2H,(H,5,6)(H,7,8)/t18?,19-,20+,24-;/m1./s1 |
| InChIKey | BGKJCYPOZCMQJD-OKVBUTJWSA-N |
| XLogP | 3.20 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.61 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|