C25H30F3N3OS — CID 143553587
1-[(1R,5S)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-[benzyl(methyl)amino]sulfanylethanone (PubChem CID 143553587) has the molecular formula C25H30F3N3OS and a molecular weight of 477.60 g/mol. Its IUPAC name is 1-[(1R,5S)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-[benzyl(methyl)amino]sulfanylethanone.
| Compound Name | 1-[(1R,5S)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-[benzyl(methyl)amino]sulfanylethanone |
|---|---|
| PubChem CID | 143553587 |
| Molecular Formula | C25H30F3N3OS |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 1-[(1R,5S)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-[benzyl(methyl)amino]sulfanylethanone |
| SMILES | CN(Cc1ccccc1)SCC(=O)N1[C@@H]2CC[C@H]1CC(C(N)Cc1cc(F)c(F)cc1F)C2 |
| InChI | InChI=1S/C25H30F3N3OS/c1-30(14-16-5-3-2-4-6-16)33-15-25(32)31-19-7-8-20(31)10-18(9-19)24(29)12-17-11-22(27)23(28)13-21(17)26/h2-6,11,13,18-20,24H,7-10,12,14-15,29H2,1H3/t18?,19-,20+,24? |
| InChIKey | JDEAIZNNHBXYKU-UDYWXPHVSA-N |
| XLogP | 4.52 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|