C19H25F3N2O4S — CID 87679047
1-[(1S,5R)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-methyl-1-oxopropane-2-sulfonic acid (PubChem CID 87679047) has the molecular formula C19H25F3N2O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is 1-[(1S,5R)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-methyl-1-oxopropane-2-sulfonic acid.
| Compound Name | 1-[(1S,5R)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-methyl-1-oxopropane-2-sulfonic acid |
|---|---|
| PubChem CID | 87679047 |
| Molecular Formula | C19H25F3N2O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 1-[(1S,5R)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-methyl-1-oxopropane-2-sulfonic acid |
| SMILES | CC(C)(C(=O)N1[C@@H]2CC[C@H]1CC([C@H](N)Cc1cc(F)c(F)cc1F)C2)S(=O)(=O)O |
| InChI | InChI=1S/C19H25F3N2O4S/c1-19(2,29(26,27)28)18(25)24-12-3-4-13(24)6-11(5-12)17(23)8-10-7-15(21)16(22)9-14(10)20/h7,9,11-13,17H,3-6,8,23H2,1-2H3,(H,26,27,28)/t11?,12-,13+,17-/m1/s1 |
| InChIKey | BSCMGFKUGHVHPZ-BHHCIPQWSA-N |
| XLogP | 2.41 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|