C24H26F3N3O2 — CID 143553585
3-[(1R,5S)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octane-8-carbonyl]-N-methylbenzamide (PubChem CID 143553585) has the molecular formula C24H26F3N3O2 and a molecular weight of 445.49 g/mol. Its IUPAC name is 3-[(1R,5S)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octane-8-carbonyl]-N-methylbenzamide.
| Compound Name | 3-[(1R,5S)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octane-8-carbonyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 143553585 |
| Molecular Formula | C24H26F3N3O2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 3-[(1R,5S)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octane-8-carbonyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(C(=O)N2[C@@H]3CC[C@H]2CC(C(N)Cc2cc(F)c(F)cc2F)C3)c1 |
| InChI | InChI=1S/C24H26F3N3O2/c1-29-23(31)13-3-2-4-14(7-13)24(32)30-17-5-6-18(30)9-16(8-17)22(28)11-15-10-20(26)21(27)12-19(15)25/h2-4,7,10,12,16-18,22H,5-6,8-9,11,28H2,1H3,(H,29,31)/t16?,17-,18+,22? |
| InChIKey | DTNRQKKXWWKIRW-CXOKAFIMSA-N |
| XLogP | 3.42 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|